C25H20N6O — CID 135685446
N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-1,5-diphenyl-1,2,4-triazole-3-carboxamide (PubChem CID 135685446) has the molecular formula C25H20N6O and a molecular weight of 420.48 g/mol. Its IUPAC name is N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-1,5-diphenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 135685446 |
| Molecular Formula | C25H20N6O |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1/C=N/NC(=O)c1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H20N6O/c1-17-21(20-14-8-9-15-22(20)27-17)16-26-29-25(32)23-28-24(18-10-4-2-5-11-18)31(30-23)19-12-6-3-7-13-19/h2-16,27H,1H3,(H,29,32)/b26-16+ |
| InChIKey | HPTUEBMFASAXAL-WGOQTCKBSA-N |
| XLogP | 4.49 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|