C25H24N4O4 — CID 135685785
5-(2,4-dimethoxyphenyl)-4-[[3-[4-(hydroxymethyl)phenyl]-4-methylphenyl]diazenyl]-1,2-dihydropyrazol-3-one (PubChem CID 135685785) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is 5-(2,4-dimethoxyphenyl)-4-[[3-[4-(hydroxymethyl)phenyl]-4-methylphenyl]diazenyl]-1,2-dihydropyrazol-3-one.
| Compound Name | 5-(2,4-dimethoxyphenyl)-4-[[3-[4-(hydroxymethyl)phenyl]-4-methylphenyl]diazenyl]-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 135685785 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 5-(2,4-dimethoxyphenyl)-4-[[3-[4-(hydroxymethyl)phenyl]-4-methylphenyl]diazenyl]-1,2-dihydropyrazol-3-one |
| SMILES | COc1ccc(-c2[nH][nH]c(=O)c2/N=N/c2ccc(C)c(-c3ccc(CO)cc3)c2)c(OC)c1 |
| InChI | InChI=1S/C25H24N4O4/c1-15-4-9-18(12-21(15)17-7-5-16(14-30)6-8-17)26-28-24-23(27-29-25(24)31)20-11-10-19(32-2)13-22(20)33-3/h4-13,30H,14H2,1-3H3,(H2,27,29,31)/b28-26+ |
| InChIKey | LTUAOBOXSBINQH-BYCLXTJYSA-N |
| XLogP | 5.27 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|