C21H24N2O2 — CID 135686108
4-methyl-2-[5-(2-methylpropyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]phenol (PubChem CID 135686108) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-methyl-2-[5-(2-methylpropyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]phenol.
| Compound Name | 4-methyl-2-[5-(2-methylpropyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]phenol |
|---|---|
| PubChem CID | 135686108 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 4-methyl-2-[5-(2-methylpropyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]phenol |
| SMILES | Cc1ccc(O)c(C2=NN3C(CC(C)C)Oc4ccccc4C3C2)c1 |
| InChI | InChI=1S/C21H24N2O2/c1-13(2)10-21-23-18(15-6-4-5-7-20(15)25-21)12-17(22-23)16-11-14(3)8-9-19(16)24/h4-9,11,13,18,21,24H,10,12H2,1-3H3 |
| InChIKey | BEAMYWSBNKKYIF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|