C16H13N5O2S — CID 135686774
(E)-3-amino-2-[2-[[5-(1H-indol-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]but-2-enenitrile (PubChem CID 135686774) has the molecular formula C16H13N5O2S and a molecular weight of 339.38 g/mol. Its IUPAC name is (E)-3-amino-2-[2-[[5-(1H-indol-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]but-2-enenitrile.
| Compound Name | (E)-3-amino-2-[2-[[5-(1H-indol-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]but-2-enenitrile |
|---|---|
| PubChem CID | 135686774 |
| Molecular Formula | C16H13N5O2S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | (E)-3-amino-2-[2-[[5-(1H-indol-3-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]but-2-enenitrile |
| SMILES | C/C(N)=C(/C#N)C(=O)CSc1nnc(-c2c[nH]c3ccccc23)o1 |
| InChI | InChI=1S/C16H13N5O2S/c1-9(18)11(6-17)14(22)8-24-16-21-20-15(23-16)12-7-19-13-5-3-2-4-10(12)13/h2-5,7,19H,8,18H2,1H3/b11-9+ |
| InChIKey | ANWGOPBJCMRRMM-PKNBQFBNSA-N |
| XLogP | 2.64 |
| TPSA | 121.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|