C25H29N3O2S — CID 135686813
3-(2-benzylsulfanyl-4-methyl-6-oxo-1H-pyrimidin-5-yl)-N-(4-tert-butylphenyl)propanamide (PubChem CID 135686813) has the molecular formula C25H29N3O2S and a molecular weight of 435.59 g/mol. Its IUPAC name is 3-(2-benzylsulfanyl-4-methyl-6-oxo-1H-pyrimidin-5-yl)-N-(4-tert-butylphenyl)propanamide.
| Compound Name | 3-(2-benzylsulfanyl-4-methyl-6-oxo-1H-pyrimidin-5-yl)-N-(4-tert-butylphenyl)propanamide |
|---|---|
| PubChem CID | 135686813 |
| Molecular Formula | C25H29N3O2S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 3-(2-benzylsulfanyl-4-methyl-6-oxo-1H-pyrimidin-5-yl)-N-(4-tert-butylphenyl)propanamide |
| SMILES | Cc1nc(SCc2ccccc2)[nH]c(=O)c1CCC(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H29N3O2S/c1-17-21(23(30)28-24(26-17)31-16-18-8-6-5-7-9-18)14-15-22(29)27-20-12-10-19(11-13-20)25(2,3)4/h5-13H,14-16H2,1-4H3,(H,27,29)(H,26,28,30) |
| InChIKey | HAORPJZREZNLMU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |