C14H15N7O3S2 — CID 135686926
2-[5-amino-3-methyl-4-[(3-phenyl-1,2,4-thiadiazol-5-yl)diazenyl]pyrazol-1-yl]ethanesulfonic acid (PubChem CID 135686926) has the molecular formula C14H15N7O3S2 and a molecular weight of 393.45 g/mol. Its IUPAC name is 2-[5-amino-3-methyl-4-[(3-phenyl-1,2,4-thiadiazol-5-yl)diazenyl]pyrazol-1-yl]ethanesulfonic acid.
| Compound Name | 2-[5-amino-3-methyl-4-[(3-phenyl-1,2,4-thiadiazol-5-yl)diazenyl]pyrazol-1-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 135686926 |
| Molecular Formula | C14H15N7O3S2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 2-[5-amino-3-methyl-4-[(3-phenyl-1,2,4-thiadiazol-5-yl)diazenyl]pyrazol-1-yl]ethanesulfonic acid |
| SMILES | Cc1nn(CCS(=O)(=O)O)c(N)c1/N=N/c1nc(-c2ccccc2)ns1 |
| InChI | InChI=1S/C14H15N7O3S2/c1-9-11(12(15)21(19-9)7-8-26(22,23)24)17-18-14-16-13(20-25-14)10-5-3-2-4-6-10/h2-6H,7-8,15H2,1H3,(H,22,23,24)/b18-17+ |
| InChIKey | ULWVNZUMYFIZNN-ISLYRVAYSA-N |
| XLogP | 2.60 |
| TPSA | 148.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|