About 1,6-dihydropyrrolo[2,3-e]indol-3-yl(phenyl)diazene
1,6-dihydropyrrolo[2,3-e]indol-3-yl(phenyl)diazene (PubChem CID 135686964) has the molecular formula C16H12N4
and a molecular weight of 260.30 g/mol. Its IUPAC name is 1,6-dihydropyrrolo[2,3-e]indol-3-yl(phenyl)diazene.
Molecular Properties
| Compound Name | 1,6-dihydropyrrolo[2,3-e]indol-3-yl(phenyl)diazene |
| PubChem CID | 135686964 |
| Molecular Formula | C16H12N4 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 1,6-dihydropyrrolo[2,3-e]indol-3-yl(phenyl)diazene |
| SMILES | c1ccc(/N=N/c2c[nH]c3c2ccc2[nH]ccc23)cc1 |
| InChI | InChI=1S/C16H12N4/c1-2-4-11(5-3-1)19-20-15-10-18-16-12(15)6-7-14-13(16)8-9-17-14/h1-10,17-18H/b20-19+ |
| InChIKey | YBOIUDLSAPEONC-FMQUCBEESA-N |
| XLogP | 5.06 |
| TPSA | 56.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 1,6-dihydropyrrolo[2,3-e]indol-3-yl(phenyl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dihydropyrrolo[2,3-e]indol-3-yl(phenyl)diazene?
The IUPAC name of 1,6-dihydropyrrolo[2,3-e]indol-3-yl(phenyl)diazene (CID 135686964) is 1,6-dihydropyrrolo[2,3-e]indol-3-yl(phenyl)diazene.
What is the SMILES notation for 1,6-dihydropyrrolo[2,3-e]indol-3-yl(phenyl)diazene?
The canonical SMILES for 1,6-dihydropyrrolo[2,3-e]indol-3-yl(phenyl)diazene is c1ccc(/N=N/c2c[nH]c3c2ccc2[nH]ccc23)cc1.
What is the InChIKey of 1,6-dihydropyrrolo[2,3-e]indol-3-yl(phenyl)diazene?
The InChIKey is YBOIUDLSAPEONC-FMQUCBEESA-N. The full InChI is InChI=1S/C16H12N4/c1-2-4-11(5-3-1)19-20-15-10-18-16-12(15)6-7-14-13(16)8-9-17-14/h1-10,17-18H/b20-19+.
What are the key properties of 1,6-dihydropyrrolo[2,3-e]indol-3-yl(phenyl)diazene?
1,6-dihydropyrrolo[2,3-e]indol-3-yl(phenyl)diazene has a molecular weight of 260.30 g/mol, XLogP of 5.06, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dihydropyrrolo[2,3-e]indol-3-yl(phenyl)diazene is sourced from PubChem (CID 135686964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).