C26H24N4O4 — CID 135687208
N-[2-[ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]-2-oxoethyl]-4-phenoxybenzamide (PubChem CID 135687208) has the molecular formula C26H24N4O4 and a molecular weight of 456.50 g/mol. Its IUPAC name is N-[2-[ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]-2-oxoethyl]-4-phenoxybenzamide.
| Compound Name | N-[2-[ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]-2-oxoethyl]-4-phenoxybenzamide |
|---|---|
| PubChem CID | 135687208 |
| Molecular Formula | C26H24N4O4 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-[2-[ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]-2-oxoethyl]-4-phenoxybenzamide |
| SMILES | CCN(Cc1nc2ccccc2c(=O)[nH]1)C(=O)CNC(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C26H24N4O4/c1-2-30(17-23-28-22-11-7-6-10-21(22)26(33)29-23)24(31)16-27-25(32)18-12-14-20(15-13-18)34-19-8-4-3-5-9-19/h3-15H,2,16-17H2,1H3,(H,27,32)(H,28,29,33) |
| InChIKey | WBQLKFTUDHDKOO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |