C18H20N4S — CID 135687357
3-[4-cyclopropyl-5-(3-methylbut-2-enylsulfanyl)-1,2,4-triazol-3-yl]-1H-indole (PubChem CID 135687357) has the molecular formula C18H20N4S and a molecular weight of 324.45 g/mol. Its IUPAC name is 3-[4-cyclopropyl-5-(3-methylbut-2-enylsulfanyl)-1,2,4-triazol-3-yl]-1H-indole.
| Compound Name | 3-[4-cyclopropyl-5-(3-methylbut-2-enylsulfanyl)-1,2,4-triazol-3-yl]-1H-indole |
|---|---|
| PubChem CID | 135687357 |
| Molecular Formula | C18H20N4S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 3-[4-cyclopropyl-5-(3-methylbut-2-enylsulfanyl)-1,2,4-triazol-3-yl]-1H-indole |
| SMILES | CC(C)=CCSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1 |
| InChI | InChI=1S/C18H20N4S/c1-12(2)9-10-23-18-21-20-17(22(18)13-7-8-13)15-11-19-16-6-4-3-5-14(15)16/h3-6,9,11,13,19H,7-8,10H2,1-2H3 |
| InChIKey | OSIZHXIFUHKMSA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|