C15H13N7S — CID 135687393
4-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine (PubChem CID 135687393) has the molecular formula C15H13N7S and a molecular weight of 323.38 g/mol. Its IUPAC name is 4-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine.
| Compound Name | 4-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine |
|---|---|
| PubChem CID | 135687393 |
| Molecular Formula | C15H13N7S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 4-(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)-1,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazol-2-amine |
| SMILES | Cc1nc2sccn2c1C1N=C(N)Nc2nc3ccccc3n21 |
| InChI | InChI=1S/C15H13N7S/c1-8-11(21-6-7-23-15(21)17-8)12-19-13(16)20-14-18-9-4-2-3-5-10(9)22(12)14/h2-7,12H,1H3,(H3,16,18,19,20) |
| InChIKey | RDVMKCGSIBNJAN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |