About 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]phenol
4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]phenol (PubChem CID 135687404) has the molecular formula C15H10FNOS
and a molecular weight of 271.32 g/mol. Its IUPAC name is 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]phenol.
Molecular Properties
| Compound Name | 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]phenol |
| PubChem CID | 135687404 |
| Molecular Formula | C15H10FNOS |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]phenol |
| SMILES | Oc1ccc(-c2nc(-c3ccc(F)cc3)cs2)cc1 |
| InChI | InChI=1S/C15H10FNOS/c16-12-5-1-10(2-6-12)14-9-19-15(17-14)11-3-7-13(18)8-4-11/h1-9,18H |
| InChIKey | JOLIFYRXVJFSNE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]phenol?
The IUPAC name of 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]phenol (CID 135687404) is 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]phenol.
What is the SMILES notation for 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]phenol?
The canonical SMILES for 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]phenol is Oc1ccc(-c2nc(-c3ccc(F)cc3)cs2)cc1.
What is the InChIKey of 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]phenol?
The InChIKey is JOLIFYRXVJFSNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10FNOS/c16-12-5-1-10(2-6-12)14-9-19-15(17-14)11-3-7-13(18)8-4-11/h1-9,18H.
What are the key properties of 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]phenol?
4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]phenol has a molecular weight of 271.32 g/mol, XLogP of 4.32, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]phenol is sourced from PubChem (CID 135687404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).