C15H12N4OS — CID 135688151
N-[(E)-(5-phenyl-1H-pyrazol-4-yl)methylideneamino]thiophene-2-carboxamide (PubChem CID 135688151) has the molecular formula C15H12N4OS and a molecular weight of 296.36 g/mol. Its IUPAC name is N-[(E)-(5-phenyl-1H-pyrazol-4-yl)methylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[(E)-(5-phenyl-1H-pyrazol-4-yl)methylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 135688151 |
| Molecular Formula | C15H12N4OS |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | N-[(E)-(5-phenyl-1H-pyrazol-4-yl)methylideneamino]thiophene-2-carboxamide |
| SMILES | O=C(N/N=C/c1cn[nH]c1-c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C15H12N4OS/c20-15(13-7-4-8-21-13)19-17-10-12-9-16-18-14(12)11-5-2-1-3-6-11/h1-10H,(H,16,18)(H,19,20)/b17-10+ |
| InChIKey | GTMDXSHLVKKCDT-LICLKQGHSA-N |
| XLogP | 2.90 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|