C12H12N2O4S — CID 135688331
4-[(E)-N-hydroxy-C-[(2-methyl-1,3-thiazol-4-yl)methyl]carbonimidoyl]benzene-1,2,3-triol (PubChem CID 135688331) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is 4-[(E)-N-hydroxy-C-[(2-methyl-1,3-thiazol-4-yl)methyl]carbonimidoyl]benzene-1,2,3-triol.
| Compound Name | 4-[(E)-N-hydroxy-C-[(2-methyl-1,3-thiazol-4-yl)methyl]carbonimidoyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 135688331 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 4-[(E)-N-hydroxy-C-[(2-methyl-1,3-thiazol-4-yl)methyl]carbonimidoyl]benzene-1,2,3-triol |
| SMILES | Cc1nc(C/C(=N\O)c2ccc(O)c(O)c2O)cs1 |
| InChI | InChI=1S/C12H12N2O4S/c1-6-13-7(5-19-6)4-9(14-18)8-2-3-10(15)12(17)11(8)16/h2-3,5,15-18H,4H2,1H3/b14-9+ |
| InChIKey | JLUDDZGFHSCHRK-NTEUORMPSA-N |
| XLogP | 1.99 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|