C18H16BrN3O2S — CID 135689420
N-(4-bromophenyl)-2-[(5R)-2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135689420) has the molecular formula C18H16BrN3O2S and a molecular weight of 418.32 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[(5R)-2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[(5R)-2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135689420 |
| Molecular Formula | C18H16BrN3O2S |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | N-(4-bromophenyl)-2-[(5R)-2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | Cc1ccc(/N=C2\NC(=O)[C@@H](CC(=O)Nc3ccc(Br)cc3)S2)cc1 |
| InChI | InChI=1S/C18H16BrN3O2S/c1-11-2-6-14(7-3-11)21-18-22-17(24)15(25-18)10-16(23)20-13-8-4-12(19)5-9-13/h2-9,15H,10H2,1H3,(H,20,23)(H,21,22,24)/t15-/m1/s1 |
| InChIKey | XDKXBRORFJOYCM-OAHLLOKOSA-N |
| XLogP | 4.01 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|