C19H20N4O2S — CID 135689456
5-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-N-cyclopropyl-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135689456) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 5-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-N-cyclopropyl-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | 5-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-N-cyclopropyl-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135689456 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 5-[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]-N-cyclopropyl-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | Cc1cc(C2=NN/C(=N/C3CC3)SC2)c(C)n1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H20N4O2S/c1-11-7-15(16-9-26-19(22-21-16)20-13-3-4-13)12(2)23(11)14-5-6-17-18(8-14)25-10-24-17/h5-8,13H,3-4,9-10H2,1-2H3,(H,20,22) |
| InChIKey | OXRADWCJCPVEOU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 60.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|