C13H15BrN4OS — CID 135689914
1-[(E)-(5-bromo-1H-indol-3-yl)methylideneamino]-3-(2-methoxyethyl)thiourea (PubChem CID 135689914) has the molecular formula C13H15BrN4OS and a molecular weight of 355.26 g/mol. Its IUPAC name is 1-[(E)-(5-bromo-1H-indol-3-yl)methylideneamino]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[(E)-(5-bromo-1H-indol-3-yl)methylideneamino]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 135689914 |
| Molecular Formula | C13H15BrN4OS |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 1-[(E)-(5-bromo-1H-indol-3-yl)methylideneamino]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)N/N=C/c1c[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C13H15BrN4OS/c1-19-5-4-15-13(20)18-17-8-9-7-16-12-3-2-10(14)6-11(9)12/h2-3,6-8,16H,4-5H2,1H3,(H2,15,18,20)/b17-8+ |
| InChIKey | YPEOCFKOBDIGIY-CAOOACKPSA-N |
| XLogP | 2.37 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|