C15H15FN2O — CID 1356900
[(S)-(3-fluorophenyl)-(4-methylphenyl)methyl]urea (PubChem CID 1356900) has the molecular formula C15H15FN2O and a molecular weight of 258.30 g/mol. Its IUPAC name is [(S)-(3-fluorophenyl)-(4-methylphenyl)methyl]urea.
| Compound Name | [(S)-(3-fluorophenyl)-(4-methylphenyl)methyl]urea |
|---|---|
| PubChem CID | 1356900 |
| Molecular Formula | C15H15FN2O |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | [(S)-(3-fluorophenyl)-(4-methylphenyl)methyl]urea |
| SMILES | Cc1ccc([C@H](NC(N)=O)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C15H15FN2O/c1-10-5-7-11(8-6-10)14(18-15(17)19)12-3-2-4-13(16)9-12/h2-9,14H,1H3,(H3,17,18,19)/t14-/m0/s1 |
| InChIKey | APMMEUOURIWFJK-AWEZNQCLSA-N |
| XLogP | 2.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |