C19H27N4O2S+ — CID 135690483
2-[[(2S,5R)-2-[4-(dimethylamino)phenyl]-1,3-oxazolidin-3-ium-5-yl]methylsulfanyl]-4-propyl-1H-pyrimidin-6-one (PubChem CID 135690483) has the molecular formula C19H27N4O2S+ and a molecular weight of 375.52 g/mol. Its IUPAC name is 2-[[(2S,5R)-2-[4-(dimethylamino)phenyl]-1,3-oxazolidin-3-ium-5-yl]methylsulfanyl]-4-propyl-1H-pyrimidin-6-one.
| Compound Name | 2-[[(2S,5R)-2-[4-(dimethylamino)phenyl]-1,3-oxazolidin-3-ium-5-yl]methylsulfanyl]-4-propyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135690483 |
| Molecular Formula | C19H27N4O2S+ |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 2-[[(2S,5R)-2-[4-(dimethylamino)phenyl]-1,3-oxazolidin-3-ium-5-yl]methylsulfanyl]-4-propyl-1H-pyrimidin-6-one |
| SMILES | CCCc1cc(=O)[nH]c(SC[C@H]2C[NH2+][C@H](c3ccc(N(C)C)cc3)O2)n1 |
| InChI | InChI=1S/C19H26N4O2S/c1-4-5-14-10-17(24)22-19(21-14)26-12-16-11-20-18(25-16)13-6-8-15(9-7-13)23(2)3/h6-10,16,18,20H,4-5,11-12H2,1-3H3,(H,21,22,24)/p+1/t16-,18+/m1/s1 |
| InChIKey | WOLLVFSSRIRKNZ-AEFFLSMTSA-O |
| XLogP | 1.54 |
| TPSA | 74.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|