About (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 4-(2,5-dimethylpyrrol-1-yl)benzoate
(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 4-(2,5-dimethylpyrrol-1-yl)benzoate (PubChem CID 135690791) has the molecular formula C20H17N3O3S
and a molecular weight of 379.44 g/mol. Its IUPAC name is (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 4-(2,5-dimethylpyrrol-1-yl)benzoate.
Molecular Properties
| Compound Name | (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 4-(2,5-dimethylpyrrol-1-yl)benzoate |
| PubChem CID | 135690791 |
| Molecular Formula | C20H17N3O3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 4-(2,5-dimethylpyrrol-1-yl)benzoate |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)OCc2nc3ccsc3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C20H17N3O3S/c1-12-3-4-13(2)23(12)15-7-5-14(6-8-15)20(25)26-11-17-21-16-9-10-27-18(16)19(24)22-17/h3-10H,11H2,1-2H3,(H,21,22,24) |
| InChIKey | QROFUFROOUTCAT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 4-(2,5-dimethylpyrrol-1-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 4-(2,5-dimethylpyrrol-1-yl)benzoate?
The IUPAC name of (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 4-(2,5-dimethylpyrrol-1-yl)benzoate (CID 135690791) is (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 4-(2,5-dimethylpyrrol-1-yl)benzoate.
What is the SMILES notation for (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 4-(2,5-dimethylpyrrol-1-yl)benzoate?
The canonical SMILES for (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 4-(2,5-dimethylpyrrol-1-yl)benzoate is Cc1ccc(C)n1-c1ccc(C(=O)OCc2nc3ccsc3c(=O)[nH]2)cc1.
What is the InChIKey of (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 4-(2,5-dimethylpyrrol-1-yl)benzoate?
The InChIKey is QROFUFROOUTCAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O3S/c1-12-3-4-13(2)23(12)15-7-5-14(6-8-15)20(25)26-11-17-21-16-9-10-27-18(16)19(24)22-17/h3-10H,11H2,1-2H3,(H,21,22,24).
What are the key properties of (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 4-(2,5-dimethylpyrrol-1-yl)benzoate?
(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 4-(2,5-dimethylpyrrol-1-yl)benzoate has a molecular weight of 379.44 g/mol, XLogP of 3.75, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 4-(2,5-dimethylpyrrol-1-yl)benzoate is sourced from PubChem (CID 135690791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).