C20H20N4O4 — CID 135690873
2-methoxy-N-[2-[methyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]-2-oxoethyl]benzamide (PubChem CID 135690873) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 2-methoxy-N-[2-[methyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 2-methoxy-N-[2-[methyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 135690873 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 2-methoxy-N-[2-[methyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]-2-oxoethyl]benzamide |
| SMILES | COc1ccccc1C(=O)NCC(=O)N(C)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C20H20N4O4/c1-24(12-17-22-15-9-5-3-7-13(15)20(27)23-17)18(25)11-21-19(26)14-8-4-6-10-16(14)28-2/h3-10H,11-12H2,1-2H3,(H,21,26)(H,22,23,27) |
| InChIKey | GCLSRDPELSFGOX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |