C19H19N3O5S — CID 135691027
ethyl 3-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-2,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 135691027) has the molecular formula C19H19N3O5S and a molecular weight of 401.44 g/mol. Its IUPAC name is ethyl 3-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-2,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 3-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-2,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135691027 |
| Molecular Formula | C19H19N3O5S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | ethyl 3-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]-2,5-dimethyl-4-oxothieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1sc2nc(C)n(/N=C/c3ccc(O)c(OC)c3)c(=O)c2c1C |
| InChI | InChI=1S/C19H19N3O5S/c1-5-27-19(25)16-10(2)15-17(28-16)21-11(3)22(18(15)24)20-9-12-6-7-13(23)14(8-12)26-4/h6-9,23H,5H2,1-4H3/b20-9+ |
| InChIKey | YZCCQCJYGCYNOE-AWQFTUOYSA-N |
| XLogP | 2.85 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|