C19H17F2N3O2S — CID 135692172
N-(2,4-difluorophenyl)-2-[(5R)-2-(2,6-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135692172) has the molecular formula C19H17F2N3O2S and a molecular weight of 389.43 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-[(5R)-2-(2,6-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-[(5R)-2-(2,6-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135692172 |
| Molecular Formula | C19H17F2N3O2S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-[(5R)-2-(2,6-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | Cc1cccc(C)c1/N=C1/NC(=O)[C@@H](CC(=O)Nc2ccc(F)cc2F)S1 |
| InChI | InChI=1S/C19H17F2N3O2S/c1-10-4-3-5-11(2)17(10)23-19-24-18(26)15(27-19)9-16(25)22-14-7-6-12(20)8-13(14)21/h3-8,15H,9H2,1-2H3,(H,22,25)(H,23,24,26)/t15-/m1/s1 |
| InChIKey | DCFYFHUUMZBEEX-OAHLLOKOSA-N |
| XLogP | 3.83 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|