C21H23N3O3S — CID 135692269
2-[(5S)-2-benzylimino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-propoxyphenyl)acetamide (PubChem CID 135692269) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is 2-[(5S)-2-benzylimino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-propoxyphenyl)acetamide.
| Compound Name | 2-[(5S)-2-benzylimino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-propoxyphenyl)acetamide |
|---|---|
| PubChem CID | 135692269 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 2-[(5S)-2-benzylimino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-propoxyphenyl)acetamide |
| SMILES | CCCOc1ccccc1NC(=O)C[C@@H]1S/C(=N\Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C21H23N3O3S/c1-2-12-27-17-11-7-6-10-16(17)23-19(25)13-18-20(26)24-21(28-18)22-14-15-8-4-3-5-9-15/h3-11,18H,2,12-14H2,1H3,(H,23,25)(H,22,24,26)/t18-/m0/s1 |
| InChIKey | NZXALUPLVOTADA-SFHVURJKSA-N |
| XLogP | 3.59 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|