About 3-methyl-6H-pyrimido[4,5-c]pyridazin-5-one
3-methyl-6H-pyrimido[4,5-c]pyridazin-5-one (PubChem CID 135692452) has the molecular formula C7H6N4O
and a molecular weight of 162.15 g/mol. Its IUPAC name is 3-methyl-6H-pyrimido[4,5-c]pyridazin-5-one.
Molecular Properties
| Compound Name | 3-methyl-6H-pyrimido[4,5-c]pyridazin-5-one |
| PubChem CID | 135692452 |
| Molecular Formula | C7H6N4O |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 3-methyl-6H-pyrimido[4,5-c]pyridazin-5-one |
| SMILES | Cc1cc2c(=O)[nH]cnc2nn1 |
| InChI | InChI=1S/C7H6N4O/c1-4-2-5-6(11-10-4)8-3-9-7(5)12/h2-3H,1H3,(H,8,9,11,12) |
| InChIKey | SYXHGTAYJBVMMT-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-6H-pyrimido[4,5-c]pyridazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6H-pyrimido[4,5-c]pyridazin-5-one?
The IUPAC name of 3-methyl-6H-pyrimido[4,5-c]pyridazin-5-one (CID 135692452) is 3-methyl-6H-pyrimido[4,5-c]pyridazin-5-one.
What is the SMILES notation for 3-methyl-6H-pyrimido[4,5-c]pyridazin-5-one?
The canonical SMILES for 3-methyl-6H-pyrimido[4,5-c]pyridazin-5-one is Cc1cc2c(=O)[nH]cnc2nn1.
What is the InChIKey of 3-methyl-6H-pyrimido[4,5-c]pyridazin-5-one?
The InChIKey is SYXHGTAYJBVMMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O/c1-4-2-5-6(11-10-4)8-3-9-7(5)12/h2-3H,1H3,(H,8,9,11,12).
What are the key properties of 3-methyl-6H-pyrimido[4,5-c]pyridazin-5-one?
3-methyl-6H-pyrimido[4,5-c]pyridazin-5-one has a molecular weight of 162.15 g/mol, XLogP of 0.02, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6H-pyrimido[4,5-c]pyridazin-5-one is sourced from PubChem (CID 135692452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).