About 5-cyclopenta-1,4-dien-1-yl-3-(5-nitrofuran-2-yl)-4,5-dihydro-1H-pyrazole
5-cyclopenta-1,4-dien-1-yl-3-(5-nitrofuran-2-yl)-4,5-dihydro-1H-pyrazole (PubChem CID 135692528) has the molecular formula C12H11N3O3
and a molecular weight of 245.24 g/mol. Its IUPAC name is 5-cyclopenta-1,4-dien-1-yl-3-(5-nitrofuran-2-yl)-4,5-dihydro-1H-pyrazole.
Molecular Properties
| Compound Name | 5-cyclopenta-1,4-dien-1-yl-3-(5-nitrofuran-2-yl)-4,5-dihydro-1H-pyrazole |
| PubChem CID | 135692528 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 5-cyclopenta-1,4-dien-1-yl-3-(5-nitrofuran-2-yl)-4,5-dihydro-1H-pyrazole |
| SMILES | O=[N+]([O-])c1ccc(C2=NNC(C3=CCC=C3)C2)o1 |
| InChI | InChI=1S/C12H11N3O3/c16-15(17)12-6-5-11(18-12)10-7-9(13-14-10)8-3-1-2-4-8/h1,3-6,9,13H,2,7H2 |
| InChIKey | MFIGGKHDAYJMOI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclopenta-1,4-dien-1-yl-3-(5-nitrofuran-2-yl)-4,5-dihydro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopenta-1,4-dien-1-yl-3-(5-nitrofuran-2-yl)-4,5-dihydro-1H-pyrazole?
The IUPAC name of 5-cyclopenta-1,4-dien-1-yl-3-(5-nitrofuran-2-yl)-4,5-dihydro-1H-pyrazole (CID 135692528) is 5-cyclopenta-1,4-dien-1-yl-3-(5-nitrofuran-2-yl)-4,5-dihydro-1H-pyrazole.
What is the SMILES notation for 5-cyclopenta-1,4-dien-1-yl-3-(5-nitrofuran-2-yl)-4,5-dihydro-1H-pyrazole?
The canonical SMILES for 5-cyclopenta-1,4-dien-1-yl-3-(5-nitrofuran-2-yl)-4,5-dihydro-1H-pyrazole is O=[N+]([O-])c1ccc(C2=NNC(C3=CCC=C3)C2)o1.
What is the InChIKey of 5-cyclopenta-1,4-dien-1-yl-3-(5-nitrofuran-2-yl)-4,5-dihydro-1H-pyrazole?
The InChIKey is MFIGGKHDAYJMOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O3/c16-15(17)12-6-5-11(18-12)10-7-9(13-14-10)8-3-1-2-4-8/h1,3-6,9,13H,2,7H2.
What are the key properties of 5-cyclopenta-1,4-dien-1-yl-3-(5-nitrofuran-2-yl)-4,5-dihydro-1H-pyrazole?
5-cyclopenta-1,4-dien-1-yl-3-(5-nitrofuran-2-yl)-4,5-dihydro-1H-pyrazole has a molecular weight of 245.24 g/mol, XLogP of 2.14, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopenta-1,4-dien-1-yl-3-(5-nitrofuran-2-yl)-4,5-dihydro-1H-pyrazole is sourced from PubChem (CID 135692528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).