C25H20N6O2 — CID 135693113
(3Z)-3-[(Z)-1-(6-oxo-1,5-diphenyl-2,5-dihydro-1,2,4-triazin-3-yl)ethylidenehydrazinylidene]-1H-indol-2-one (PubChem CID 135693113) has the molecular formula C25H20N6O2 and a molecular weight of 436.48 g/mol. Its IUPAC name is (3Z)-3-[(Z)-1-(6-oxo-1,5-diphenyl-2,5-dihydro-1,2,4-triazin-3-yl)ethylidenehydrazinylidene]-1H-indol-2-one.
| Compound Name | (3Z)-3-[(Z)-1-(6-oxo-1,5-diphenyl-2,5-dihydro-1,2,4-triazin-3-yl)ethylidenehydrazinylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 135693113 |
| Molecular Formula | C25H20N6O2 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | (3Z)-3-[(Z)-1-(6-oxo-1,5-diphenyl-2,5-dihydro-1,2,4-triazin-3-yl)ethylidenehydrazinylidene]-1H-indol-2-one |
| SMILES | C/C(=N/N=C1\C(=O)Nc2ccccc21)C1=NC(c2ccccc2)C(=O)N(c2ccccc2)N1 |
| InChI | InChI=1S/C25H20N6O2/c1-16(28-29-22-19-14-8-9-15-20(19)26-24(22)32)23-27-21(17-10-4-2-5-11-17)25(33)31(30-23)18-12-6-3-7-13-18/h2-15,21H,1H3,(H,27,30)(H,26,29,32)/b28-16- |
| InChIKey | FRVVLKCXXOUUDT-NTFVMDSBSA-N |
| XLogP | 3.49 |
| TPSA | 98.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|