C22H27N3O2 — CID 135693581
methyl (4R,5S,6R)-2-benzylimino-1-ethyl-6-methyl-4-phenyl-1,3-diazinane-5-carboxylate (PubChem CID 135693581) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is methyl (4R,5S,6R)-2-benzylimino-1-ethyl-6-methyl-4-phenyl-1,3-diazinane-5-carboxylate.
| Compound Name | methyl (4R,5S,6R)-2-benzylimino-1-ethyl-6-methyl-4-phenyl-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 135693581 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | methyl (4R,5S,6R)-2-benzylimino-1-ethyl-6-methyl-4-phenyl-1,3-diazinane-5-carboxylate |
| SMILES | CCN1/C(=N\Cc2ccccc2)N[C@@H](c2ccccc2)[C@H](C(=O)OC)[C@H]1C |
| InChI | InChI=1S/C22H27N3O2/c1-4-25-16(2)19(21(26)27-3)20(18-13-9-6-10-14-18)24-22(25)23-15-17-11-7-5-8-12-17/h5-14,16,19-20H,4,15H2,1-3H3,(H,23,24)/t16-,19-,20+/m1/s1 |
| InChIKey | NRBDUROVHLTIAX-AHRSYUTCSA-N |
| XLogP | 3.39 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|