C22H28N4O2 — CID 135693590
methyl (4R,5S,6R)-1-ethyl-6-methyl-4-phenyl-2-(2-pyridin-3-ylethylimino)-1,3-diazinane-5-carboxylate (PubChem CID 135693590) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is methyl (4R,5S,6R)-1-ethyl-6-methyl-4-phenyl-2-(2-pyridin-3-ylethylimino)-1,3-diazinane-5-carboxylate.
| Compound Name | methyl (4R,5S,6R)-1-ethyl-6-methyl-4-phenyl-2-(2-pyridin-3-ylethylimino)-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 135693590 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | methyl (4R,5S,6R)-1-ethyl-6-methyl-4-phenyl-2-(2-pyridin-3-ylethylimino)-1,3-diazinane-5-carboxylate |
| SMILES | CCN1/C(=N\CCc2cccnc2)N[C@@H](c2ccccc2)[C@H](C(=O)OC)[C@H]1C |
| InChI | InChI=1S/C22H28N4O2/c1-4-26-16(2)19(21(27)28-3)20(18-10-6-5-7-11-18)25-22(26)24-14-12-17-9-8-13-23-15-17/h5-11,13,15-16,19-20H,4,12,14H2,1-3H3,(H,24,25)/t16-,19-,20+/m1/s1 |
| InChIKey | HQMPZXHJADPLRQ-AHRSYUTCSA-N |
| XLogP | 2.82 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|