C22H29BrN4O4S — CID 135694238
propan-2-yl 7-(3-bromo-4,5-dimethoxyphenyl)-2-butylsulfanyl-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135694238) has the molecular formula C22H29BrN4O4S and a molecular weight of 525.47 g/mol. Its IUPAC name is propan-2-yl 7-(3-bromo-4,5-dimethoxyphenyl)-2-butylsulfanyl-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | propan-2-yl 7-(3-bromo-4,5-dimethoxyphenyl)-2-butylsulfanyl-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135694238 |
| Molecular Formula | C22H29BrN4O4S |
| Molecular Weight | 525.47 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | propan-2-yl 7-(3-bromo-4,5-dimethoxyphenyl)-2-butylsulfanyl-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCSc1nc2n(n1)C(c1cc(Br)c(OC)c(OC)c1)C(C(=O)OC(C)C)=C(C)N2 |
| InChI | InChI=1S/C22H29BrN4O4S/c1-7-8-9-32-22-25-21-24-13(4)17(20(28)31-12(2)3)18(27(21)26-22)14-10-15(23)19(30-6)16(11-14)29-5/h10-12,18H,7-9H2,1-6H3,(H,24,25,26) |
| InChIKey | JWZVQGQLWNWUQZ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|