C27H28Cl2N4O3S — CID 135694954
prop-2-enyl 2-butylsulfanyl-7-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135694954) has the molecular formula C27H28Cl2N4O3S and a molecular weight of 559.52 g/mol. Its IUPAC name is prop-2-enyl 2-butylsulfanyl-7-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | prop-2-enyl 2-butylsulfanyl-7-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135694954 |
| Molecular Formula | C27H28Cl2N4O3S |
| Molecular Weight | 559.52 g/mol |
| Exact Mass | 558.13 |
| IUPAC Name | prop-2-enyl 2-butylsulfanyl-7-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)Nc2nc(SCCCC)nn2C1c1ccc(OCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C27H28Cl2N4O3S/c1-4-6-14-37-27-31-26-30-17(3)23(25(34)35-13-5-2)24(33(26)32-27)19-8-10-20(11-9-19)36-16-18-7-12-21(28)22(29)15-18/h5,7-12,15,24H,2,4,6,13-14,16H2,1,3H3,(H,30,31,32) |
| InChIKey | AQNBAZLOQZIPPD-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.52 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|