About (3S,5S)-5-cyclopenta-1,4-dien-1-yl-3-hydroxy-1-methylpyrrolidin-2-one
(3S,5S)-5-cyclopenta-1,4-dien-1-yl-3-hydroxy-1-methylpyrrolidin-2-one (PubChem CID 135697412) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is (3S,5S)-5-cyclopenta-1,4-dien-1-yl-3-hydroxy-1-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | (3S,5S)-5-cyclopenta-1,4-dien-1-yl-3-hydroxy-1-methylpyrrolidin-2-one |
| PubChem CID | 135697412 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (3S,5S)-5-cyclopenta-1,4-dien-1-yl-3-hydroxy-1-methylpyrrolidin-2-one |
| SMILES | CN1C(=O)[C@@H](O)C[C@H]1C1=CCC=C1 |
| InChI | InChI=1S/C10H13NO2/c1-11-8(6-9(12)10(11)13)7-4-2-3-5-7/h2,4-5,8-9,12H,3,6H2,1H3/t8-,9-/m0/s1 |
| InChIKey | LEKKAAXXFCCSBJ-IUCAKERBSA-N |
| XLogP | 0.46 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,5S)-5-cyclopenta-1,4-dien-1-yl-3-hydroxy-1-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5S)-5-cyclopenta-1,4-dien-1-yl-3-hydroxy-1-methylpyrrolidin-2-one?
The IUPAC name of (3S,5S)-5-cyclopenta-1,4-dien-1-yl-3-hydroxy-1-methylpyrrolidin-2-one (CID 135697412) is (3S,5S)-5-cyclopenta-1,4-dien-1-yl-3-hydroxy-1-methylpyrrolidin-2-one.
What is the SMILES notation for (3S,5S)-5-cyclopenta-1,4-dien-1-yl-3-hydroxy-1-methylpyrrolidin-2-one?
The canonical SMILES for (3S,5S)-5-cyclopenta-1,4-dien-1-yl-3-hydroxy-1-methylpyrrolidin-2-one is CN1C(=O)[C@@H](O)C[C@H]1C1=CCC=C1.
What is the InChIKey of (3S,5S)-5-cyclopenta-1,4-dien-1-yl-3-hydroxy-1-methylpyrrolidin-2-one?
The InChIKey is LEKKAAXXFCCSBJ-IUCAKERBSA-N. The full InChI is InChI=1S/C10H13NO2/c1-11-8(6-9(12)10(11)13)7-4-2-3-5-7/h2,4-5,8-9,12H,3,6H2,1H3/t8-,9-/m0/s1.
What are the key properties of (3S,5S)-5-cyclopenta-1,4-dien-1-yl-3-hydroxy-1-methylpyrrolidin-2-one?
(3S,5S)-5-cyclopenta-1,4-dien-1-yl-3-hydroxy-1-methylpyrrolidin-2-one has a molecular weight of 179.22 g/mol, XLogP of 0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5S)-5-cyclopenta-1,4-dien-1-yl-3-hydroxy-1-methylpyrrolidin-2-one is sourced from PubChem (CID 135697412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).