About (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 3-morpholin-4-ylsulfonylbenzoate
(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 3-morpholin-4-ylsulfonylbenzoate (PubChem CID 135697665) has the molecular formula C18H17N3O6S2
and a molecular weight of 435.48 g/mol. Its IUPAC name is (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 3-morpholin-4-ylsulfonylbenzoate.
Molecular Properties
| Compound Name | (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 3-morpholin-4-ylsulfonylbenzoate |
| PubChem CID | 135697665 |
| Molecular Formula | C18H17N3O6S2 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 3-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(OCc1nc2ccsc2c(=O)[nH]1)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C18H17N3O6S2/c22-17-16-14(4-9-28-16)19-15(20-17)11-27-18(23)12-2-1-3-13(10-12)29(24,25)21-5-7-26-8-6-21/h1-4,9-10H,5-8,11H2,(H,19,20,22) |
| InChIKey | PWGRKAHKFWQADY-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 118.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 3-morpholin-4-ylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 3-morpholin-4-ylsulfonylbenzoate?
The IUPAC name of (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 3-morpholin-4-ylsulfonylbenzoate (CID 135697665) is (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 3-morpholin-4-ylsulfonylbenzoate.
What is the SMILES notation for (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 3-morpholin-4-ylsulfonylbenzoate?
The canonical SMILES for (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 3-morpholin-4-ylsulfonylbenzoate is O=C(OCc1nc2ccsc2c(=O)[nH]1)c1cccc(S(=O)(=O)N2CCOCC2)c1.
What is the InChIKey of (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 3-morpholin-4-ylsulfonylbenzoate?
The InChIKey is PWGRKAHKFWQADY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O6S2/c22-17-16-14(4-9-28-16)19-15(20-17)11-27-18(23)12-2-1-3-13(10-12)29(24,25)21-5-7-26-8-6-21/h1-4,9-10H,5-8,11H2,(H,19,20,22).
What are the key properties of (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 3-morpholin-4-ylsulfonylbenzoate?
(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 3-morpholin-4-ylsulfonylbenzoate has a molecular weight of 435.48 g/mol, XLogP of 1.36, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 3-morpholin-4-ylsulfonylbenzoate is sourced from PubChem (CID 135697665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).