C30H37FN6O5S — CID 135698237
1-[4-ethoxy-3-(5-methyl-7-nonan-3-yl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazin-2-yl)phenyl]-3-(4-fluorophenyl)sulfonylurea (PubChem CID 135698237) has the molecular formula C30H37FN6O5S and a molecular weight of 612.73 g/mol. Its IUPAC name is 1-[4-ethoxy-3-(5-methyl-7-nonan-3-yl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazin-2-yl)phenyl]-3-(4-fluorophenyl)sulfonylurea.
| Compound Name | 1-[4-ethoxy-3-(5-methyl-7-nonan-3-yl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazin-2-yl)phenyl]-3-(4-fluorophenyl)sulfonylurea |
|---|---|
| PubChem CID | 135698237 |
| Molecular Formula | C30H37FN6O5S |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.25 |
| IUPAC Name | 1-[4-ethoxy-3-(5-methyl-7-nonan-3-yl-4-oxo-3H-imidazo[5,1-f][1,2,4]triazin-2-yl)phenyl]-3-(4-fluorophenyl)sulfonylurea |
| SMILES | CCCCCCC(CC)c1nc(C)c2c(=O)[nH]c(-c3cc(NC(=O)NS(=O)(=O)c4ccc(F)cc4)ccc3OCC)nn12 |
| InChI | InChI=1S/C30H37FN6O5S/c1-5-8-9-10-11-20(6-2)28-32-19(4)26-29(38)34-27(35-37(26)28)24-18-22(14-17-25(24)42-7-3)33-30(39)36-43(40,41)23-15-12-21(31)13-16-23/h12-18,20H,5-11H2,1-4H3,(H2,33,36,39)(H,34,35,38) |
| InChIKey | LTDJGIBVRPWQCN-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 147.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|