C22H27N7O2 — CID 135698304
2-[5-(azidomethyl)-2-ethoxyphenyl]-7-cycloheptyl-5-methyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one (PubChem CID 135698304) has the molecular formula C22H27N7O2 and a molecular weight of 421.51 g/mol. Its IUPAC name is 2-[5-(azidomethyl)-2-ethoxyphenyl]-7-cycloheptyl-5-methyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[5-(azidomethyl)-2-ethoxyphenyl]-7-cycloheptyl-5-methyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 135698304 |
| Molecular Formula | C22H27N7O2 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 2-[5-(azidomethyl)-2-ethoxyphenyl]-7-cycloheptyl-5-methyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one |
| SMILES | CCOc1ccc(CN=[N+]=[N-])cc1-c1nn2c(C3CCCCCC3)nc(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C22H27N7O2/c1-3-31-18-11-10-15(13-24-28-23)12-17(18)20-26-22(30)19-14(2)25-21(29(19)27-20)16-8-6-4-5-7-9-16/h10-12,16H,3-9,13H2,1-2H3,(H,26,27,30) |
| InChIKey | CNZXIIZOGFIOFK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 121.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|