C8H10ClF3N6 — CID 135699082
3-(3,5-dimethyl-1H-pyrazol-2-ium-2-yl)-5-(trifluoromethyl)-1,2,4-triazol-4-amine chloride (PubChem CID 135699082) has the molecular formula C8H10ClF3N6 and a molecular weight of 282.66 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1H-pyrazol-2-ium-2-yl)-5-(trifluoromethyl)-1,2,4-triazol-4-amine chloride.
| Compound Name | 3-(3,5-dimethyl-1H-pyrazol-2-ium-2-yl)-5-(trifluoromethyl)-1,2,4-triazol-4-amine chloride |
|---|---|
| PubChem CID | 135699082 |
| Molecular Formula | C8H10ClF3N6 |
| Molecular Weight | 282.66 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 3-(3,5-dimethyl-1H-pyrazol-2-ium-2-yl)-5-(trifluoromethyl)-1,2,4-triazol-4-amine chloride |
| SMILES | Cc1cc(C)[n+](-c2nnc(C(F)(F)F)n2N)[nH]1.[Cl-] |
| InChI | InChI=1S/C8H9F3N6.ClH/c1-4-3-5(2)17(15-4)7-14-13-6(16(7)12)8(9,10)11;/h3H,12H2,1-2H3;1H |
| InChIKey | XBZQCDXSIWFYGU-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 76.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.66 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|