C8H11N6O+ — CID 135699173
3-N-[(E)-furan-2-ylmethylideneamino]-5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine (PubChem CID 135699173) has the molecular formula C8H11N6O+ and a molecular weight of 207.22 g/mol. Its IUPAC name is 3-N-[(E)-furan-2-ylmethylideneamino]-5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine.
| Compound Name | 3-N-[(E)-furan-2-ylmethylideneamino]-5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine |
|---|---|
| PubChem CID | 135699173 |
| Molecular Formula | C8H11N6O+ |
| Molecular Weight | 207.22 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 3-N-[(E)-furan-2-ylmethylideneamino]-5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine |
| SMILES | Cc1[nH]nc(N/N=C/c2ccco2)[n+]1N |
| InChI | InChI=1S/C8H10N6O/c1-6-11-13-8(14(6)9)12-10-5-7-3-2-4-15-7/h2-5H,9H2,1H3,(H,12,13)/p+1/b10-5+ |
| InChIKey | AUOBAUTVMOQJMR-BJMVGYQFSA-O |
| XLogP | -0.24 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.22 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|