C11H16N2O — CID 135700406
(NE)-N-(1-methylimino-4a,5,6,7,8,8a-hexahydronaphthalen-2-ylidene)hydroxylamine (PubChem CID 135700406) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is (NE)-N-(1-methylimino-4a,5,6,7,8,8a-hexahydronaphthalen-2-ylidene)hydroxylamine.
| Compound Name | (NE)-N-(1-methylimino-4a,5,6,7,8,8a-hexahydronaphthalen-2-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 135700406 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | (NE)-N-(1-methylimino-4a,5,6,7,8,8a-hexahydronaphthalen-2-ylidene)hydroxylamine |
| SMILES | C/N=C1C(=N\O)\C=CC2CCCCC\12 |
| InChI | InChI=1S/C11H16N2O/c1-12-11-9-5-3-2-4-8(9)6-7-10(11)13-14/h6-9,14H,2-5H2,1H3/b12-11-,13-10+ |
| InChIKey | RUSBENYTOVBCRA-QOLBIDBBSA-N |
| XLogP | 2.26 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|