About 3-amino-2-methyl-6-phenyl-5H-pyrazolo[3,4-d]pyrimidin-4-one
3-amino-2-methyl-6-phenyl-5H-pyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 135702343) has the molecular formula C12H11N5O
and a molecular weight of 241.25 g/mol. Its IUPAC name is 3-amino-2-methyl-6-phenyl-5H-pyrazolo[3,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-amino-2-methyl-6-phenyl-5H-pyrazolo[3,4-d]pyrimidin-4-one |
| PubChem CID | 135702343 |
| Molecular Formula | C12H11N5O |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 3-amino-2-methyl-6-phenyl-5H-pyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | Cn1nc2nc(-c3ccccc3)[nH]c(=O)c2c1N |
| InChI | InChI=1S/C12H11N5O/c1-17-9(13)8-11(16-17)14-10(15-12(8)18)7-5-3-2-4-6-7/h2-6H,13H2,1H3,(H,14,15,16,18) |
| InChIKey | PZITXWDOOWICST-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-2-methyl-6-phenyl-5H-pyrazolo[3,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-methyl-6-phenyl-5H-pyrazolo[3,4-d]pyrimidin-4-one?
The IUPAC name of 3-amino-2-methyl-6-phenyl-5H-pyrazolo[3,4-d]pyrimidin-4-one (CID 135702343) is 3-amino-2-methyl-6-phenyl-5H-pyrazolo[3,4-d]pyrimidin-4-one.
What is the SMILES notation for 3-amino-2-methyl-6-phenyl-5H-pyrazolo[3,4-d]pyrimidin-4-one?
The canonical SMILES for 3-amino-2-methyl-6-phenyl-5H-pyrazolo[3,4-d]pyrimidin-4-one is Cn1nc2nc(-c3ccccc3)[nH]c(=O)c2c1N.
What is the InChIKey of 3-amino-2-methyl-6-phenyl-5H-pyrazolo[3,4-d]pyrimidin-4-one?
The InChIKey is PZITXWDOOWICST-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N5O/c1-17-9(13)8-11(16-17)14-10(15-12(8)18)7-5-3-2-4-6-7/h2-6H,13H2,1H3,(H,14,15,16,18).
What are the key properties of 3-amino-2-methyl-6-phenyl-5H-pyrazolo[3,4-d]pyrimidin-4-one?
3-amino-2-methyl-6-phenyl-5H-pyrazolo[3,4-d]pyrimidin-4-one has a molecular weight of 241.25 g/mol, XLogP of 0.91, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-methyl-6-phenyl-5H-pyrazolo[3,4-d]pyrimidin-4-one is sourced from PubChem (CID 135702343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).