C11H18N6O2S2 — CID 135702422
3-N-[2-[(1,5-dimethylimidazol-4-yl)methylsulfanyl]ethyl]-4-N-methyl-1,1-dioxo-1,2,5-thiadiazolidine-3,4-diimine (PubChem CID 135702422) has the molecular formula C11H18N6O2S2 and a molecular weight of 330.44 g/mol. Its IUPAC name is 3-N-[2-[(1,5-dimethylimidazol-4-yl)methylsulfanyl]ethyl]-4-N-methyl-1,1-dioxo-1,2,5-thiadiazolidine-3,4-diimine.
| Compound Name | 3-N-[2-[(1,5-dimethylimidazol-4-yl)methylsulfanyl]ethyl]-4-N-methyl-1,1-dioxo-1,2,5-thiadiazolidine-3,4-diimine |
|---|---|
| PubChem CID | 135702422 |
| Molecular Formula | C11H18N6O2S2 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 3-N-[2-[(1,5-dimethylimidazol-4-yl)methylsulfanyl]ethyl]-4-N-methyl-1,1-dioxo-1,2,5-thiadiazolidine-3,4-diimine |
| SMILES | C/N=C1\NS(=O)(=O)N\C1=N\CCSCc1ncn(C)c1C |
| InChI | InChI=1S/C11H18N6O2S2/c1-8-9(14-7-17(8)3)6-20-5-4-13-11-10(12-2)15-21(18,19)16-11/h7H,4-6H2,1-3H3,(H,12,15)(H,13,16) |
| InChIKey | OUNSCUNSLHNZHQ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 100.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|