About 1H-pyrrolo[2,3-g]quinoxaline
1H-pyrrolo[2,3-g]quinoxaline (PubChem CID 135703143) has the molecular formula C10H7N3
and a molecular weight of 169.19 g/mol. Its IUPAC name is 1H-pyrrolo[2,3-g]quinoxaline.
Molecular Properties
| Compound Name | 1H-pyrrolo[2,3-g]quinoxaline |
| PubChem CID | 135703143 |
| Molecular Formula | C10H7N3 |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 1H-pyrrolo[2,3-g]quinoxaline |
| SMILES | c1cc2cc3[nH]ccnc3cc2n1 |
| InChI | InChI=1S/C10H7N3/c1-2-11-8-6-10-9(5-7(1)8)12-3-4-13-10/h1-6,12H |
| InChIKey | ZEQXBOVKCSVJPK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-pyrrolo[2,3-g]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrolo[2,3-g]quinoxaline?
The IUPAC name of 1H-pyrrolo[2,3-g]quinoxaline (CID 135703143) is 1H-pyrrolo[2,3-g]quinoxaline.
What is the SMILES notation for 1H-pyrrolo[2,3-g]quinoxaline?
The canonical SMILES for 1H-pyrrolo[2,3-g]quinoxaline is c1cc2cc3[nH]ccnc3cc2n1.
What is the InChIKey of 1H-pyrrolo[2,3-g]quinoxaline?
The InChIKey is ZEQXBOVKCSVJPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3/c1-2-11-8-6-10-9(5-7(1)8)12-3-4-13-10/h1-6,12H.
What are the key properties of 1H-pyrrolo[2,3-g]quinoxaline?
1H-pyrrolo[2,3-g]quinoxaline has a molecular weight of 169.19 g/mol, XLogP of 2.11, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrolo[2,3-g]quinoxaline is sourced from PubChem (CID 135703143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).