C23H23ClN6OS — CID 135703190
6-[[3-(4-chlorophenyl)phenyl]methyl]-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-4H-1,2,4-triazin-5-one (PubChem CID 135703190) has the molecular formula C23H23ClN6OS and a molecular weight of 467.00 g/mol. Its IUPAC name is 6-[[3-(4-chlorophenyl)phenyl]methyl]-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-4H-1,2,4-triazin-5-one.
| Compound Name | 6-[[3-(4-chlorophenyl)phenyl]methyl]-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135703190 |
| Molecular Formula | C23H23ClN6OS |
| Molecular Weight | 467.00 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 6-[[3-(4-chlorophenyl)phenyl]methyl]-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-4H-1,2,4-triazin-5-one |
| SMILES | Cc1[nH]cnc1CSCCNc1nnc(Cc2cccc(-c3ccc(Cl)cc3)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C23H23ClN6OS/c1-15-21(27-14-26-15)13-32-10-9-25-23-28-22(31)20(29-30-23)12-16-3-2-4-18(11-16)17-5-7-19(24)8-6-17/h2-8,11,14H,9-10,12-13H2,1H3,(H,26,27)(H2,25,28,30,31) |
| InChIKey | DLROXRVJXLOAOI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.00 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|