C23H20ClN3O2S — CID 135703259
5-(4-chlorophenyl)-3-[(3,4-dimethoxyphenyl)methyl]-1H-1,3,4-benzotriazepine-2-thione (PubChem CID 135703259) has the molecular formula C23H20ClN3O2S and a molecular weight of 437.95 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[(3,4-dimethoxyphenyl)methyl]-1H-1,3,4-benzotriazepine-2-thione.
| Compound Name | 5-(4-chlorophenyl)-3-[(3,4-dimethoxyphenyl)methyl]-1H-1,3,4-benzotriazepine-2-thione |
|---|---|
| PubChem CID | 135703259 |
| Molecular Formula | C23H20ClN3O2S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[(3,4-dimethoxyphenyl)methyl]-1H-1,3,4-benzotriazepine-2-thione |
| SMILES | COc1ccc(CN2N=C(c3ccc(Cl)cc3)c3ccccc3NC2=S)cc1OC |
| InChI | InChI=1S/C23H20ClN3O2S/c1-28-20-12-7-15(13-21(20)29-2)14-27-23(30)25-19-6-4-3-5-18(19)22(26-27)16-8-10-17(24)11-9-16/h3-13H,14H2,1-2H3,(H,25,30) |
| InChIKey | QUNDUYLLJVCJKN-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|