C22H20ClN3OS2 — CID 135703260
5-(4-chlorophenyl)-3-[(4-methoxyphenyl)methyl]-6,7-dimethyl-1H-thieno[2,3-e][1,2,4]triazepine-2-thione (PubChem CID 135703260) has the molecular formula C22H20ClN3OS2 and a molecular weight of 442.01 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[(4-methoxyphenyl)methyl]-6,7-dimethyl-1H-thieno[2,3-e][1,2,4]triazepine-2-thione.
| Compound Name | 5-(4-chlorophenyl)-3-[(4-methoxyphenyl)methyl]-6,7-dimethyl-1H-thieno[2,3-e][1,2,4]triazepine-2-thione |
|---|---|
| PubChem CID | 135703260 |
| Molecular Formula | C22H20ClN3OS2 |
| Molecular Weight | 442.01 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[(4-methoxyphenyl)methyl]-6,7-dimethyl-1H-thieno[2,3-e][1,2,4]triazepine-2-thione |
| SMILES | COc1ccc(CN2N=C(c3ccc(Cl)cc3)c3c(sc(C)c3C)NC2=S)cc1 |
| InChI | InChI=1S/C22H20ClN3OS2/c1-13-14(2)29-21-19(13)20(16-6-8-17(23)9-7-16)25-26(22(28)24-21)12-15-4-10-18(27-3)11-5-15/h4-11H,12H2,1-3H3,(H,24,28) |
| InChIKey | OTVUQTWXWBUWCE-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.01 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|