C16H24N4O6 — CID 135703336
9-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethyl)-1H-purin-6-one (PubChem CID 135703336) has the molecular formula C16H24N4O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is 9-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethyl)-1H-purin-6-one.
| Compound Name | 9-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 135703336 |
| Molecular Formula | C16H24N4O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 9-(1,4,7,10,13-pentaoxacyclopentadec-2-ylmethyl)-1H-purin-6-one |
| SMILES | O=c1[nH]cnc2c1ncn2CC1COCCOCCOCCOCCO1 |
| InChI | InChI=1S/C16H24N4O6/c21-16-14-15(17-11-18-16)20(12-19-14)9-13-10-25-6-5-23-2-1-22-3-4-24-7-8-26-13/h11-13H,1-10H2,(H,17,18,21) |
| InChIKey | FXFFMUBJKYAIFT-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |