C6H6N4O2 — CID 135703371
3,5,7,8-tetrahydropteridine-4,6-dione (PubChem CID 135703371) has the molecular formula C6H6N4O2 and a molecular weight of 166.14 g/mol. Its IUPAC name is 3,5,7,8-tetrahydropteridine-4,6-dione.
| Compound Name | 3,5,7,8-tetrahydropteridine-4,6-dione |
|---|---|
| PubChem CID | 135703371 |
| Molecular Formula | C6H6N4O2 |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 3,5,7,8-tetrahydropteridine-4,6-dione |
| SMILES | O=C1CNc2nc[nH]c(=O)c2N1 |
| InChI | InChI=1S/C6H6N4O2/c11-3-1-7-5-4(10-3)6(12)9-2-8-5/h2H,1H2,(H,10,11)(H2,7,8,9,12) |
| InChIKey | NPRMDOXQPYAPFS-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |