About 3-ethyl-2-hydroxy-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one
3-ethyl-2-hydroxy-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one (PubChem CID 135703668) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 3-ethyl-2-hydroxy-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-ethyl-2-hydroxy-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one |
| PubChem CID | 135703668 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 3-ethyl-2-hydroxy-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one |
| SMILES | CCc1c(O)nc2n(c1=O)CCC2 |
| InChI | InChI=1S/C9H12N2O2/c1-2-6-8(12)10-7-4-3-5-11(7)9(6)13/h12H,2-5H2,1H3 |
| InChIKey | XKVTTWQEPJDBKX-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-2-hydroxy-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-hydroxy-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one?
The IUPAC name of 3-ethyl-2-hydroxy-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one (CID 135703668) is 3-ethyl-2-hydroxy-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 3-ethyl-2-hydroxy-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one?
The canonical SMILES for 3-ethyl-2-hydroxy-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one is CCc1c(O)nc2n(c1=O)CCC2.
What is the InChIKey of 3-ethyl-2-hydroxy-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one?
The InChIKey is XKVTTWQEPJDBKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-2-6-8(12)10-7-4-3-5-11(7)9(6)13/h12H,2-5H2,1H3.
What are the key properties of 3-ethyl-2-hydroxy-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one?
3-ethyl-2-hydroxy-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one has a molecular weight of 180.21 g/mol, XLogP of 0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-hydroxy-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 135703668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).