C11H14N4O3 — CID 135704115
9-[(1R,2S,3R,4S)-2,3-dihydroxy-4-methylcyclopentyl]-1H-purin-6-one (PubChem CID 135704115) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is 9-[(1R,2S,3R,4S)-2,3-dihydroxy-4-methylcyclopentyl]-1H-purin-6-one.
| Compound Name | 9-[(1R,2S,3R,4S)-2,3-dihydroxy-4-methylcyclopentyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135704115 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 9-[(1R,2S,3R,4S)-2,3-dihydroxy-4-methylcyclopentyl]-1H-purin-6-one |
| SMILES | C[C@H]1C[C@@H](n2cnc3c(=O)[nH]cnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H14N4O3/c1-5-2-6(9(17)8(5)16)15-4-14-7-10(15)12-3-13-11(7)18/h3-6,8-9,16-17H,2H2,1H3,(H,12,13,18)/t5-,6+,8+,9-/m0/s1 |
| InChIKey | UZEOAVRGNBAIJW-LWIVVEGESA-N |
| XLogP | -0.58 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |