About 2-[(2-aminophenyl)iminomethyl]-4,6-ditert-butylphenol
2-[(2-aminophenyl)iminomethyl]-4,6-ditert-butylphenol (PubChem CID 135705170) has the molecular formula C21H28N2O
and a molecular weight of 324.47 g/mol. Its IUPAC name is 2-[(2-aminophenyl)iminomethyl]-4,6-ditert-butylphenol.
Molecular Properties
| Compound Name | 2-[(2-aminophenyl)iminomethyl]-4,6-ditert-butylphenol |
| PubChem CID | 135705170 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 2-[(2-aminophenyl)iminomethyl]-4,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(/C=N/c2ccccc2N)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H28N2O/c1-20(2,3)15-11-14(19(24)16(12-15)21(4,5)6)13-23-18-10-8-7-9-17(18)22/h7-13,24H,22H2,1-6H3/b23-13+ |
| InChIKey | WOIXERHXLOOLRS-YDZHTSKRSA-N |
| XLogP | 5.32 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-aminophenyl)iminomethyl]-4,6-ditert-butylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-aminophenyl)iminomethyl]-4,6-ditert-butylphenol?
The IUPAC name of 2-[(2-aminophenyl)iminomethyl]-4,6-ditert-butylphenol (CID 135705170) is 2-[(2-aminophenyl)iminomethyl]-4,6-ditert-butylphenol.
What is the SMILES notation for 2-[(2-aminophenyl)iminomethyl]-4,6-ditert-butylphenol?
The canonical SMILES for 2-[(2-aminophenyl)iminomethyl]-4,6-ditert-butylphenol is CC(C)(C)c1cc(/C=N/c2ccccc2N)c(O)c(C(C)(C)C)c1.
What is the InChIKey of 2-[(2-aminophenyl)iminomethyl]-4,6-ditert-butylphenol?
The InChIKey is WOIXERHXLOOLRS-YDZHTSKRSA-N. The full InChI is InChI=1S/C21H28N2O/c1-20(2,3)15-11-14(19(24)16(12-15)21(4,5)6)13-23-18-10-8-7-9-17(18)22/h7-13,24H,22H2,1-6H3/b23-13+.
What are the key properties of 2-[(2-aminophenyl)iminomethyl]-4,6-ditert-butylphenol?
2-[(2-aminophenyl)iminomethyl]-4,6-ditert-butylphenol has a molecular weight of 324.47 g/mol, XLogP of 5.32, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-aminophenyl)iminomethyl]-4,6-ditert-butylphenol is sourced from PubChem (CID 135705170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).