About 4-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)phenol
4-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)phenol (PubChem CID 135705205) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 4-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)phenol.
Molecular Properties
| Compound Name | 4-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)phenol |
| PubChem CID | 135705205 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 4-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)phenol |
| SMILES | CC1CN=C(c2ccc(O)cc2)N1 |
| InChI | InChI=1S/C10H12N2O/c1-7-6-11-10(12-7)8-2-4-9(13)5-3-8/h2-5,7,13H,6H2,1H3,(H,11,12) |
| InChIKey | PMBQYJGSKZZJKC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)phenol?
The IUPAC name of 4-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)phenol (CID 135705205) is 4-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)phenol.
What is the SMILES notation for 4-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)phenol?
The canonical SMILES for 4-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)phenol is CC1CN=C(c2ccc(O)cc2)N1.
What is the InChIKey of 4-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)phenol?
The InChIKey is PMBQYJGSKZZJKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c1-7-6-11-10(12-7)8-2-4-9(13)5-3-8/h2-5,7,13H,6H2,1H3,(H,11,12).
What are the key properties of 4-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)phenol?
4-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)phenol has a molecular weight of 176.22 g/mol, XLogP of 1.13, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)phenol is sourced from PubChem (CID 135705205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).