About (NE)-N-[[1-(2,2-dimethylpropoxymethyl)-3-methylimidazol-3-ium-2-yl]methylidene]hydroxylamine chloride
(NE)-N-[[1-(2,2-dimethylpropoxymethyl)-3-methylimidazol-3-ium-2-yl]methylidene]hydroxylamine chloride (PubChem CID 135705445) has the molecular formula C11H20ClN3O2
and a molecular weight of 261.75 g/mol. Its IUPAC name is (NE)-N-[[1-(2,2-dimethylpropoxymethyl)-3-methylimidazol-3-ium-2-yl]methylidene]hydroxylamine chloride.
Molecular Properties
| Compound Name | (NE)-N-[[1-(2,2-dimethylpropoxymethyl)-3-methylimidazol-3-ium-2-yl]methylidene]hydroxylamine chloride |
| PubChem CID | 135705445 |
| Molecular Formula | C11H20ClN3O2 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | (NE)-N-[[1-(2,2-dimethylpropoxymethyl)-3-methylimidazol-3-ium-2-yl]methylidene]hydroxylamine chloride |
| SMILES | C[n+]1ccn(COCC(C)(C)C)c1/C=N/O.[Cl-] |
| InChI | InChI=1S/C11H19N3O2.ClH/c1-11(2,3)8-16-9-14-6-5-13(4)10(14)7-12-15;/h5-7H,8-9H2,1-4H3;1H |
| InChIKey | NCSMVVOBRKZSPZ-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 50.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[[1-(2,2-dimethylpropoxymethyl)-3-methylimidazol-3-ium-2-yl]methylidene]hydroxylamine chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[[1-(2,2-dimethylpropoxymethyl)-3-methylimidazol-3-ium-2-yl]methylidene]hydroxylamine chloride?
The IUPAC name of (NE)-N-[[1-(2,2-dimethylpropoxymethyl)-3-methylimidazol-3-ium-2-yl]methylidene]hydroxylamine chloride (CID 135705445) is (NE)-N-[[1-(2,2-dimethylpropoxymethyl)-3-methylimidazol-3-ium-2-yl]methylidene]hydroxylamine chloride.
What is the SMILES notation for (NE)-N-[[1-(2,2-dimethylpropoxymethyl)-3-methylimidazol-3-ium-2-yl]methylidene]hydroxylamine chloride?
The canonical SMILES for (NE)-N-[[1-(2,2-dimethylpropoxymethyl)-3-methylimidazol-3-ium-2-yl]methylidene]hydroxylamine chloride is C[n+]1ccn(COCC(C)(C)C)c1/C=N/O.[Cl-].
What is the InChIKey of (NE)-N-[[1-(2,2-dimethylpropoxymethyl)-3-methylimidazol-3-ium-2-yl]methylidene]hydroxylamine chloride?
The InChIKey is NCSMVVOBRKZSPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O2.ClH/c1-11(2,3)8-16-9-14-6-5-13(4)10(14)7-12-15;/h5-7H,8-9H2,1-4H3;1H.
What are the key properties of (NE)-N-[[1-(2,2-dimethylpropoxymethyl)-3-methylimidazol-3-ium-2-yl]methylidene]hydroxylamine chloride?
(NE)-N-[[1-(2,2-dimethylpropoxymethyl)-3-methylimidazol-3-ium-2-yl]methylidene]hydroxylamine chloride has a molecular weight of 261.75 g/mol, XLogP of -1.86, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[[1-(2,2-dimethylpropoxymethyl)-3-methylimidazol-3-ium-2-yl]methylidene]hydroxylamine chloride is sourced from PubChem (CID 135705445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).